CAS 777857-53-1

3-(4-Chlorophenyl)-5,9-dimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-propanoic acid

Description:

3-(4-Chlorophenyl)-5,9-dimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-propanoic acid, with CAS number 777857-53-1, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a furobenzopyran moiety. This compound features a chlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the propanoic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The dimethyl and keto substituents enhance its structural diversity, potentially impacting its pharmacological profile. Such compounds are often investigated for their potential therapeutic applications, including anti-inflammatory or anticancer properties, due to their ability to interact with biological targets. The specific arrangement of functional groups and the overall molecular architecture play a crucial role in determining the compound's chemical behavior, stability, and interaction with other molecules. Further studies would be necessary to elucidate its full range of properties and potential applications in medicinal chemistry.

Formula: C₂₂H₁₇ClO₅

InChI: InChI=1S/C22H17ClO5/c1-11-15(7-8-19(24)25)22(26)28-21-12(2)20-17(9-16(11)21)18(10-27-20)13-3-5-14(23)6-4-13/h3-6,9-10H,7-8H2,1-2H3,(H,24,25)

InChI key: InChIKey=UIWDQXWMFKAHRL-UHFFFAOYSA-N

SMILES: CC1=C2C(C(=CO2)C3=CC=C(Cl)C=C3)=CC4=C1OC(=O)C(CCC(O)=O)=C4C

Synonyms:

• 3-(4-Chlorophenyl)-5,9-dimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-propanoic acid
• 7H-Furo[3,2-g][1]benzopyran-6-propanoic acid, 3-(4-chlorophenyl)-5,9-dimethyl-7-oxo-