CymitQuimica logo

CAS 777867-04-6

:

6,7-dihydro[1,2,4]triazolo[5,1-b]quinazolin-8(5H)-one

Description:
6,7-Dihydro[1,2,4]triazolo[5,1-b]quinazolin-8(5H)-one is a heterocyclic compound characterized by its unique fused triazole and quinazoline structures. This compound features a triazole ring, which contributes to its potential biological activity, and a quinazolinone moiety, known for its pharmacological properties. The presence of the dihydro group indicates that it has undergone partial hydrogenation, affecting its reactivity and stability. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the fields of oncology and neurology, due to their ability to interact with various biological targets. The molecular structure suggests that it may exhibit properties such as anti-inflammatory, antimicrobial, or anticancer activities, although specific biological data would be required to confirm these effects. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific formulation and purity. Overall, 6,7-dihydro[1,2,4]triazolo[5,1-b]quinazolin-8(5H)-one represents a class of compounds with significant potential in medicinal chemistry.
Formula:C9H8N4O
InChI:InChI=1/C9H8N4O/c14-8-3-1-2-7-6(8)4-13-9(12-7)10-5-11-13/h4-5H,1-3H2
SMILES:C1Cc2c(cn3c(ncn3)n2)C(=O)C1
Synonyms:
  • [1,2,4]triazolo[5,1-b]quinazolin-8(5H)-one, 6,7-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.