CAS 777886-76-7
:2-(2-thienyl)azetidine
Description:
2-(2-Thienyl)azetidine is a heterocyclic organic compound characterized by the presence of a four-membered azetidine ring and a thienyl group, which is derived from thiophene. This compound features a sulfur atom within the thienyl moiety, contributing to its unique chemical properties. The azetidine ring is known for its strain due to the small ring size, which can influence its reactivity and stability. Typically, compounds like 2-(2-thienyl)azetidine exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The presence of the thienyl group can enhance lipophilicity and potentially improve the compound's ability to interact with biological targets. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of both the azetidine and thienyl functionalities. Overall, 2-(2-thienyl)azetidine represents a valuable structure for further exploration in synthetic and medicinal chemistry.
Formula:C7H9NS
InChI:InChI=1/C7H9NS/c1-2-7(9-5-1)6-3-4-8-6/h1-2,5-6,8H,3-4H2
SMILES:c1cc(C2CCN2)sc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
