CAS 777887-12-4
:2-(3-methoxyphenyl)azetidine
Description:
2-(3-Methoxyphenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 3-methoxyphenyl group indicates that there is a methoxy (-OCH3) substituent on the aromatic ring, specifically at the meta position relative to the azetidine attachment. This compound may exhibit interesting pharmacological properties due to the combination of the azetidine framework and the aromatic methoxy group, potentially influencing its interactions with biological targets. The molecular structure suggests that it could participate in various chemical reactions typical of both azetidines and aromatic compounds, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the presence of the methoxy group can enhance solubility and influence the compound's overall polarity. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied or utilized.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-12-9-4-2-3-8(7-9)10-5-6-11-10/h2-4,7,10-11H,5-6H2,1H3
SMILES:COc1cccc(c1)C1CCN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.