CAS 7779-17-1
:Cyclohexyl cinnamate
Description:
Cyclohexyl cinnamate is an organic compound characterized by its ester functional group, formed from the reaction of cyclohexanol and cinnamic acid. It typically appears as a colorless to pale yellow liquid with a pleasant, sweet aroma, making it useful in the fragrance and flavor industry. The compound is known for its low solubility in water but is soluble in organic solvents such as ethanol and ether. Cyclohexyl cinnamate exhibits UV-absorbing properties, which makes it valuable in cosmetic formulations as a UV filter. Additionally, it has applications in the production of polymers and as an intermediate in organic synthesis. The compound's stability under normal conditions and its relatively low toxicity contribute to its utility in various industrial applications. However, like many organic compounds, it should be handled with care, following appropriate safety guidelines to minimize exposure.
Formula:C15H18O2
InChI:InChI=1S/C15H18O2/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2
InChI key:InChIKey=GCFAUZGWPDYAJN-UHFFFAOYSA-N
SMILES:O(C(C=CC1=CC=CC=C1)=O)C2CCCCC2
Synonyms:- 2-Propenoic acid, 3-phenyl-, cyclohexyl ester
- NSC 71968
- Cyclohexyl cinnamate
- Cinnamic acid, cyclohexyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
