CymitQuimica logo

CAS 7779-27-3

:

1,3,5-Triethylhexahydro-1,3,5-triazine

Description:
1,3,5-Triethylhexahydro-1,3,5-triazine, with the CAS number 7779-27-3, is a cyclic organic compound characterized by its triazine ring structure, which is fully saturated. This compound features three ethyl groups attached to the triazine ring, contributing to its unique chemical properties. It is typically colorless to pale yellow in appearance and has a relatively low boiling point, indicating it may be volatile under certain conditions. The presence of the triazine moiety suggests potential applications in various fields, including agriculture as a herbicide or in the synthesis of other chemical compounds. Its chemical stability and reactivity can vary depending on environmental conditions, such as temperature and pH. Additionally, 1,3,5-triazines are known for their ability to form hydrogen bonds, which can influence their solubility in different solvents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H21N3
InChI:InChI=1S/C9H21N3/c1-4-10-7-11(5-2)9-12(6-3)8-10/h4-9H2,1-3H3
InChI key:InChIKey=XYRTVIAPRQLSOW-UHFFFAOYSA-N
SMILES:C(C)N1CN(CC)CN(CC)C1
Synonyms:
  • Hexahydro-1,3,5-triethyl-s-triazine
  • 1,3,5-Triazine, 1,3,5-triethylhexahydro-
  • 1,3,5-Triethylhexahydro-1,3,5-triazine
  • Triethyl-trimethylenetriamine
  • s-Triazine, 1,3,5-triethylhexahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.