CAS 7779-81-9
:Isobutyl angelate
Description:
Isobutyl angelate, with the CAS number 7779-81-9, is an ester formed from the reaction of isobutanol and angelic acid. It is characterized by its pleasant fruity aroma, which makes it a popular choice in the flavor and fragrance industries. The compound typically appears as a colorless to pale yellow liquid and is known for its low volatility and moderate solubility in water, while being more soluble in organic solvents. Isobutyl angelate has a relatively low boiling point, which contributes to its use in various applications, including food flavoring and perfumery. Additionally, it is considered to have low toxicity, making it suitable for use in consumer products. Its chemical structure features a branched isobutyl group attached to the angelate moiety, which influences its sensory properties and reactivity. As with many esters, it can undergo hydrolysis in the presence of water and acids or bases, leading to the formation of the corresponding alcohol and acid.
Formula:C9H16O2
InChI:InChI=1S/C9H16O2/c1-5-8(4)9(10)11-6-7(2)3/h5,7H,6H2,1-4H3/b8-5-
InChI key:InChIKey=XDEGQMQKHFPBEW-YVMONPNESA-N
SMILES:C(OCC(C)C)(/C(=C\C)/C)=O
Synonyms:- (Z)-Isobutyl 2-methylbut-2-enoate
- 2-Butenoic acid, 2-methyl-, 2-methylpropyl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 2-methylpropyl ester, (Z)-
- 2-Methylpropyl 2-Methylbut-2-Enoate
- 2-Methylpropyl 2-methyl-2-butenoate, (Z)-
- 2-methylpropyl (2Z)-2-methylbut-2-enoate
- Angelicacidisobutylester
- Crotonic acid, 2-methyl-, isobutyl ester, (Z)-
- Einecs 231-941-7
- FEMA No. 2180
- Isobutyl 2-methylcrotonoate, (Z)-
- Isobutyl 2-methylisocrotonate
- Isobutyl angelate
- Isobutyl cis-2-methyl-2-butenoate
- iso-Butyl Angelate = Angelic acid Iso-butyl ester
- Angelic acid, isobutyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isobutyl Angelate
CAS:Formula:C9H16O2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:156.23Isobutyl angelate
CAS:<p>Isobutyl angelate(2-methylpropyl (2Z)-2-methylbut-2-enoate) is an ester commonly used in flavor preparation, organic synthesis and biochemical experiments.</p>Formula:C9H16O2Purity:97.82%Color and Shape:SolidMolecular weight:156.22Angelic acid isobutyl ester
CAS:<p>Angelic acid isobutyl ester</p>Purity:98%Molecular weight:156.22g/mol



