CymitQuimica logo

CAS 777934-39-1

:

N~2~-benzyl-N-[4-(benzyloxy)phenyl]glycinamide

Description:
N~2~-benzyl-N-[4-(benzyloxy)phenyl]glycinamide, with the CAS number 777934-39-1, is a synthetic organic compound characterized by its unique molecular structure, which includes a glycinamide backbone substituted with a benzyl group and a para-benzyloxyphenyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential bioactivity due to its ability to interact with biological targets. The presence of the benzyloxy group may enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the compound may exhibit specific reactivity patterns typical of amides, including potential hydrogen bonding and participation in various chemical reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and stability are essential for understanding its full potential and safety profile in practical applications.
Formula:C22H22N2O2
InChI:InChI=1/C22H22N2O2/c25-22(16-23-15-18-7-3-1-4-8-18)24-20-11-13-21(14-12-20)26-17-19-9-5-2-6-10-19/h1-14,23H,15-17H2,(H,24,25)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.