CymitQuimica logo

CAS 777934-41-5

:

2-[benzyl-[(2S)-3-chloro-2-hydroxy-propyl]amino]-N-(4-benzyloxyphenyl)acetamide

Description:
2-[Benzyl-[(2S)-3-chloro-2-hydroxy-propyl]amino]-N-(4-benzyloxyphenyl)acetamide is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as an amine, an acetamide, and a phenolic ether. The presence of a chloro group and a hydroxy group on the propyl chain contributes to its potential biological activity, possibly influencing its solubility and reactivity. The compound features a benzyl group, which can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Its molecular architecture suggests that it may interact with biological targets, making it of interest in medicinal chemistry. The compound's specific stereochemistry, indicated by the (2S) designation, may also play a crucial role in its biological interactions. Overall, this compound's unique combination of structural elements positions it as a candidate for further investigation in drug development or as a biochemical probe. However, detailed studies would be necessary to elucidate its specific properties, mechanisms of action, and potential applications.
Formula:C25H27ClN2O3
InChI:InChI=1/C25H27ClN2O3/c26-15-23(29)17-28(16-20-7-3-1-4-8-20)18-25(30)27-22-11-13-24(14-12-22)31-19-21-9-5-2-6-10-21/h1-14,23,29H,15-19H2,(H,27,30)/t23-/m1/s1
Synonyms:
  • N2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.