
CAS 777934-42-6
:(6R)-6-(Hydroxymethyl)-1-[4-(phenylmethoxy)phenyl]-4-(phenylmethyl)-2-piperazinone
Description:
The chemical substance known as (6R)-6-(Hydroxymethyl)-1-[4-(phenylmethoxy)phenyl]-4-(phenylmethyl)-2-piperazinone, with the CAS number 777934-42-6, is a piperazinone derivative characterized by its complex structure that includes a piperazine ring, hydroxymethyl group, and multiple phenyl substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may influence interactions with biological targets. The presence of the hydroxymethyl group can enhance its reactivity and solubility, while the phenyl groups may contribute to its lipophilicity and ability to cross biological membranes. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The stereochemistry indicated by the (6R) designation suggests specific spatial arrangements that can significantly affect the compound's biological activity and interaction with receptors or enzymes. Overall, this substance represents a class of compounds that may have therapeutic potential, warranting further research into its biological effects and mechanisms of action.
Formula:C25H26N2O3
InChI:InChI=1S/C25H26N2O3/c28-18-23-16-26(15-20-7-3-1-4-8-20)17-25(29)27(23)22-11-13-24(14-12-22)30-19-21-9-5-2-6-10-21/h1-14,23,28H,15-19H2/t23-/m1/s1
InChI key:InChIKey=IAVHITPTJAGRMP-HSZRJFAPSA-N
SMILES:C(O)[C@@H]1N(C(=O)CN(CC2=CC=CC=C2)C1)C3=CC=C(OCC4=CC=CC=C4)C=C3
Synonyms:- (6R)-4-Benzyl-6-(hydroxymethyl)-1-(4-phenylmethoxyphenyl)piperazin-2-one
- Piperazinone, 6-(hydroxymethyl)-1-[4-(phenylmethoxy)phenyl]-4-(phenylmethyl)-, (6R)-
- (6R)-6-(Hydroxymethyl)-1-[4-(phenylmethoxy)phenyl]-4-(phenylmethyl)-2-piperazinone
- 2-Piperazinone, 6-(hydroxymethyl)-1-[4-(phenylmethoxy)phenyl]-4-(phenylmethyl)-, (6R)-
- (6R)-4-Benzyl-1-(4-benzyloxyphenyl)-6-hydroxymethylpiperazin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.