CAS 777946-04-0

2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoro-4-methyl-pentanoic acid

Description:

2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoro-4-methyl-pentanoic acid is a synthetic organic compound characterized by its complex structure, which includes a fluorenylmethoxycarbonyl (Fmoc) protecting group, a trifluoromethyl group, and a branched pentanoic acid backbone. This compound is typically used in peptide synthesis and as a building block in medicinal chemistry due to its ability to protect amino groups during reactions. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity. The Fmoc group allows for easy removal under mild basic conditions, making it a popular choice in solid-phase peptide synthesis. Additionally, the compound's unique structure may impart specific interactions with biological targets, making it of interest in drug development. Its solubility, stability, and reactivity are influenced by the functional groups present, which can affect its application in various chemical and pharmaceutical contexts.

Formula: C₂₁H₂₀F₃NO₄

InChI: InChI=1/C21H20F3NO4/c1-12(21(22,23)24)10-18(19(26)27)25-20(28)29-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17-18H,10-11H2,1H3,(H,25,28)(H,26,27)

SMILES: CC(CC(C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)C(F)(F)F

Synonyms:

• N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-5,5,5-trifluoroleucine

Fmoc-5,5,5-trifluoro-DL-leucine

CAS: 777946-04-0

Molecular weight: 407.39

Ref: 7W-GM4806