CymitQuimica logo

CAS 77797-65-0

:

2-Chloro-5-(trifluoromethoxy)benzenesulfonyl chloride

Description:
2-Chloro-5-(trifluoromethoxy)benzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides and other derivatives. This compound features a chloro substituent and a trifluoromethoxy group, which contribute to its unique chemical properties, including increased electronegativity and potential for strong intermolecular interactions. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its solubility in organic solvents. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The compound is likely to be sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Overall, 2-Chloro-5-(trifluoromethoxy)benzenesulfonyl chloride is a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals.
Formula:C7H3Cl2F3O3S
InChI:InChI=1S/C7H3Cl2F3O3S/c8-5-2-1-4(15-7(10,11)12)3-6(5)16(9,13)14/h1-3H
InChI key:InChIKey=JGKVFWNIQYMJCN-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC(OC(F)(F)F)=CC=C1Cl
Synonyms:
  • 2-Chloro-5-(trifluoromethoxy)benzenesulfonyl chloride
  • Benzenesulfonyl chloride, 2-chloro-5-(trifluoromethoxy)-
  • 2-Chloro-5-(trifluoromethoxy)benzene-1-sulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.