CAS 77797-67-2

2-Chloro-5-(trifluoromethoxy)benzenesulfonamide

Description:

2-Chloro-5-(trifluoromethoxy)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is attached to a benzene ring that also features a chlorine atom and a trifluoromethoxy group. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity can vary based on its structure. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. The chlorine atom contributes to the compound's overall polarity and can affect its interaction with biological targets. Additionally, the sulfonamide moiety is known for its ability to form hydrogen bonds, which can play a crucial role in its pharmacological properties. Overall, 2-Chloro-5-(trifluoromethoxy)benzenesulfonamide is a compound of interest in medicinal chemistry and may be explored for various applications, including as a potential therapeutic agent.

Formula: C₇H₅ClF₃NO₃S

InChI: InChI=1S/C7H5ClF3NO3S/c8-5-2-1-4(15-7(9,10)11)3-6(5)16(12,13)14/h1-3H,(H2,12,13,14)

InChI key: InChIKey=KAADJMTUBAFAKX-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(OC(F)(F)F)=CC=C1Cl

Synonyms:

• 2-Chloro-5-(trifluoromethoxy)benzenesulfonamide
• Benzenesulfonamide, 2-chloro-5-(trifluoromethoxy)-
• 2-Chloro-5-(trifluoromethoxy)benzene-1-sulfonamide