CAS 77798-10-8
:2-(difluoromethoxy)benzenesulfonyl chloride
Description:
2-(Difluoromethoxy)benzenesulfonyl chloride, with the CAS number 77798-10-8, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that also features a difluoromethoxy substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially in the preparation of sulfonamides and other derivatives. The difluoromethoxy group enhances its electrophilicity and can influence the compound's solubility and reactivity. Additionally, it may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Its applications can extend to pharmaceuticals and agrochemicals, where it serves as an important building block in the synthesis of more complex molecules.
Formula:C7H5ClF2O3S
InChI:InChI=1/C7H5ClF2O3S/c8-14(11,12)6-4-2-1-3-5(6)13-7(9)10/h1-4,7H
SMILES:c1ccc(c(c1)OC(F)F)S(=O)(=O)Cl
Synonyms:- Benzenesulfonyl Chloride, 2-(Difluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.