CAS 778-09-6
:N-(3-methyltricyclo[3.3.1.1~3,7~]dec-1-yl)acetamide
Description:
N-(3-methyltricyclo[3.3.1.1^3,7]dec-1-yl)acetamide, with the CAS number 778-09-6, is a chemical compound characterized by its unique tricyclic structure, which contributes to its distinctive physical and chemical properties. This compound features a tricyclic decane framework, which is further substituted with a methyl group and an acetamide functional group. The presence of the acetamide moiety suggests that it may exhibit polar characteristics, potentially influencing its solubility in various solvents. The compound's tricyclic nature may impart rigidity to its molecular structure, affecting its reactivity and interaction with biological systems. Additionally, the specific arrangement of atoms within the tricyclic system can lead to interesting stereochemical properties, which may be relevant in pharmacological contexts. Overall, N-(3-methyltricyclo[3.3.1.1^3,7]dec-1-yl)acetamide is a compound of interest in organic chemistry and may have applications in medicinal chemistry or materials science, depending on its biological activity and physical properties.
Formula:C13H21NO
InChI:InChI=1/C13H21NO/c1-9(15)14-13-6-10-3-11(7-13)5-12(2,4-10)8-13/h10-11H,3-8H2,1-2H3,(H,14,15)
SMILES:CC(=NC12CC3CC(CC(C)(C3)C2)C1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Acetyl demethyl memantine
CAS:N-Acetyl demethyl memantine is a cyclic molecule. It is a monohydrate and has the chemical formula C8H14N2O3. This compound is white and crystalline, with an empirical formula of CHNO. N-Acetyl demethyl memantine has been shown to be more efficient than its linear counterpart in inhibiting the formation of amyloid plaques in Alzheimer's disease. The cyclic form of this drug has also been shown to inhibit the production of amyloid beta-peptides by preventing their aggregation into oligomers, thereby reducing the amount of amyloid plaques produced.Formula:C13H21NOPurity:Min. 95%Molecular weight:207.31 g/mol



