CAS 778-24-5

Dimethyldiphenylsilane; 97%

Description:

Dimethyldiphenylsilane, with the CAS number 778-24-5, is an organosilicon compound characterized by its silane structure, which includes two methyl groups and two phenyl groups attached to a silicon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its low volatility and high thermal stability. It is often utilized in various applications, including as a coupling agent, surface modifier, and in the synthesis of silicone polymers. Dimethyldiphenylsilane exhibits hydrophobic properties, making it useful in enhancing the water resistance of materials. Additionally, it can participate in chemical reactions typical of silanes, such as hydrolysis and condensation, leading to the formation of siloxane networks. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, its unique chemical structure and properties make it valuable in both industrial and research settings.

Formula: C₁₄H₁₆Si

InChI: InChI=1/C14H16Si/c1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3

SMILES: C[Si](C)(c1ccccc1)c1ccccc1

Synonyms:

• Dimethyldiphenylsilane
• Dichloro(Diphenyl)Silane

Dimethyldiphenylsilane

CAS: 778-24-5

Formula: C₁₄H₁₆Si

Purity: >97.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 212.37

Ref: 3B-D1810

Dimethyldiphenylsilane

CAS: 778-24-5

Formula: C₁₄H₁₆Si

Purity: 99%

Color and Shape: Liquid

Molecular weight: 212.3623

Ref: IN-DA003PN6

Dimethyldiphenylsilane

CAS: 778-24-5

Dimethyldiphenylsilane

Purity: 99%

Molecular weight: 212.37g/mol

Ref: 54-OR1012954

Diphenyldimethylsilane

CAS: 778-24-5

Formula: C₁₄H₁₆Si

Purity: 97%

Color and Shape: Liquid

Molecular weight: 212.367

Ref: 10-S07915

BiphenyldiMethylsilane

CAS: 778-24-5

BiphenyldiMethylsilane is a reactive compound that can be used for the surface modification of metals. It reacts with metal carbonyls, such as ZrO2, to form an oxide layer on the metal surface. This reaction can be monitored by magnetic resonance spectroscopy and chemical structures. The reactive site of this compound is a hydroxyl group, which will react with chloride ions to form a zirconium chloride complex. The chemical ionization technique can be used to determine the surface concentrations of this compound. BiphenyldiMethylsilane is often used in analytical chemistry to detect metal ions on surfaces or in films using infrared spectroscopy or mass spectrometry.

Purity: Min. 95%

Ref: 3D-FB39983