CAS 778-29-0
:3-Buten-1-ol, 1-(4-methylbenzenesulfonate)
Description:
3-Buten-1-ol, 1-(4-methylbenzenesulfonate), also known as 4-methylbenzenesulfonic acid 3-butenyl ester, is an organic compound characterized by its sulfonate functional group attached to a butenyl alcohol. This compound features a butene chain, which contributes to its reactivity, particularly in addition reactions due to the presence of the double bond. The sulfonate group enhances its solubility in polar solvents and can facilitate nucleophilic substitution reactions. Typically, this compound is used in organic synthesis and may serve as an intermediate in the production of various chemical products. Its structure allows for potential applications in polymer chemistry and as a reagent in various chemical transformations. Safety data indicates that, like many sulfonates, it should be handled with care, as it may pose risks such as skin irritation or respiratory issues upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C11H14O3S
InChI:InChI=1S/C11H14O3S/c1-3-4-9-14-15(12,13)11-7-5-10(2)6-8-11/h3,5-8H,1,4,9H2,2H3
InChI key:InChIKey=RMVHRBRSQIDTKT-UHFFFAOYSA-N
SMILES:S(OCCC=C)(=O)(=O)C1=CC=C(C)C=C1
Synonyms:- 3-Buten-1-ol, p-toluenesulfonate
- 1-Tosyloxy-3-butene
- 3-Butenyl p-toluenesulfonate
- 3-Buten-1-ol, 1-(4-methylbenzenesulfonate)
- 3-Buten-1-ol, 4-methylbenzenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
