CAS 778-48-3
:2,3-dihydrophenanthren-4(1H)-one
Description:
2,3-Dihydrophenanthren-4(1H)-one, with the CAS number 778-48-3, is an organic compound that belongs to the class of phenanthrenes, which are polycyclic aromatic hydrocarbons. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. It is characterized by its fused ring structure, consisting of three fused benzene rings, which imparts significant stability and hydrophobic properties. The presence of the ketone group enhances its ability to participate in various chemical reactions, such as nucleophilic additions and reductions. 2,3-Dihydrophenanthren-4(1H)-one is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure and properties make it of interest in fields such as materials science, organic chemistry, and medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H12O
InChI:InChI=1/C14H12O/c15-13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-2,4,6,8-9H,3,5,7H2
SMILES:c1ccc2c(c1)ccc1CCCC(=O)c21
Synonyms:- 4(1H)-Phenanthrenone, 2,3-dihydro-
- 4-Keto-1,2,3,4-Tetrahydrophenanthrene
- 2,3-Dihydrophenanthren-4(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Dihydrophenanthren-4(1H)-one
CAS:Formula:C14H12OPurity:98%Color and Shape:SolidMolecular weight:196.24452,3-Dihydrophenanthren-4(1H)-one
CAS:2,3-Dihydrophenanthren-4(1H)-onePurity:98%Color and Shape:SolidMolecular weight:196.24g/mol1,2,3,4-Tetrahydrophenanthren-4-one
CAS:Controlled ProductApplications Biodegradation product of Phenanthrene.
References Singleton, D., et al.: Environ. Microbiol., 8, 1736 (2006), Sorensen, U., et al.: J. Med. Chem., 51, 7625 (2008),Formula:C14H12OColor and Shape:NeatMolecular weight:196.241,2,3,4-Tetrahydrophenanthren-4-one
CAS:1,2,3,4-Tetrahydrophenanthren-4-one is a synthetic quinone that is used as an intermediate in the Diels–Alder reaction. The compound has been shown to react with benzyne and amine molecules to form semicarbazones. 1,2,3,4-Tetrahydrophenanthren-4-one can be used as a reactive probe for studying intramolecular interactions. It can also be used to synthesize polycyclic compounds such as tetrafluoroborates. 1,2,3,4-Tetrahydrophenanthren-4-one can also serve as a reagent for the synthesis of frameworks such as zeolites.
Formula:C14H12OPurity:Min. 95%Color and Shape:PowderMolecular weight:196.24 g/molRef: 3D-FT28131
Discontinued product




