CAS 778-83-6
:2-(2,4,6-Trichlorophenoxy)propanoic acid
Description:
2-(2,4,6-Trichlorophenoxy)propanoic acid, commonly known as triclopyr, is a synthetic herbicide primarily used for controlling woody plants and broadleaf weeds. It belongs to the class of phenoxy herbicides and is characterized by its ability to mimic natural plant hormones, leading to uncontrolled growth and eventual plant death. The chemical structure features a propanoic acid moiety linked to a 2,4,6-trichlorophenoxy group, which contributes to its herbicidal activity. Triclopyr is typically applied in forestry, agriculture, and aquatic environments, and it is known for its selective action, allowing it to target specific plant species while minimizing harm to desirable vegetation. The substance is generally considered to have low toxicity to mammals, but it can be harmful to aquatic organisms, necessitating careful application and adherence to safety guidelines. Its environmental persistence varies, and it is subject to regulatory scrutiny to ensure safe use in various applications.
Formula:C9H7Cl3O3
InChI:InChI=1S/C9H7Cl3O3/c1-4(9(13)14)15-8-6(11)2-5(10)3-7(8)12/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=HNDLJIIQWDVRRI-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)C)C1=C(Cl)C=C(Cl)C=C1Cl
Synonyms:- 2-(2,4,6-Trichlorophenoxy)Propanoic Acid
- 3-(2,4,6-Trichlorophenoxy)Propanoic Acid
- NSC 65584
- Propanoic acid, 2-(2,4,6-trichlorophenoxy)-
- Propionic acid, 2-(2,4,6-trichlorophenoxy)-
- 2-(2,4,6-Trichlorophenoxy)propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.