CymitQuimica logo

CAS 7781-23-9

:

2,4-dimethoxy-6-methylpyrimidine

Description:
2,4-Dimethoxy-6-methylpyrimidine is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features two methoxy groups (-OCH3) at the 2 and 4 positions and a methyl group (-CH3) at the 6 position of the pyrimidine ring. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-5-4-6(10-2)9-7(8-5)11-3/h4H,1-3H3
InChI key:XEWINPXUCNYESQ-UHFFFAOYSA-N
SMILES:Cc1cc(nc(n1)OC)OC
Found 3 products.