CAS 7781-26-2

5-bromo-4,6-dichloropyrimidin-2-amine

Description:

5-Bromo-4,6-dichloropyrimidin-2-amine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two chlorine atoms and one bromine atom as substituents. The presence of the amino group (-NH2) at the 2-position of the pyrimidine ring contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure suggests that it could participate in nucleophilic substitution reactions due to the electron-withdrawing effects of the halogen substituents, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the halogen atoms can influence the compound's biological activity, potentially enhancing its efficacy in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₄H₂BrCl₂N₃

InChI: InChI=1/C4H2BrCl2N3/c5-1-2(6)9-4(8)10-3(1)7/h(H2,8,9,10)

SMILES: c1(c(Cl)[nH]c(=N)nc1Cl)Br

Synonyms:

• 2-Pyrimidinamine, 5-Bromo-4,6-Dichloro-

5-Bromo-4,6-dichloropyrimidin-2-amine

CAS: 7781-26-2

Formula: C₄H₂BrCl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.8888

Ref: IN-DA005F2B

2-Amino-5-bromo-4,6-dichloropyrimidine

CAS: 7781-26-2

2-Amino-5-bromo-4,6-dichloropyrimidine

Purity: 95%

Color and Shape: Powder

Molecular weight: 242.89g/mol

Ref: 54-OR2987

5-Bromo-4,6-dichloropyrimidin-2-amine

CAS: 7781-26-2

Formula: C₄H₂BrCl₂N₃

Purity: 97%

Molecular weight: 242.89

Ref: 10-F067413