CAS 77822-84-5

N-[(E)-pyridin-3-ylmethylidene]-1,3-benzodioxol-5-amine

Description:

N-[(E)-pyridin-3-ylmethylidene]-1,3-benzodioxol-5-amine, with the CAS number 77822-84-5, is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical interactions. It may display biological activity due to the presence of the amine functional group, which can participate in hydrogen bonding and other interactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit interesting pharmacological properties. Additionally, its solubility and reactivity can be influenced by the substituents on the aromatic rings, making it a candidate for further study in organic synthesis and drug design. Overall, N-[(E)-pyridin-3-ylmethylidene]-1,3-benzodioxol-5-amine represents a class of compounds that may offer valuable insights into chemical behavior and potential therapeutic applications.

Formula: C₁₃H₁₀N₂O₂

InChI: InChI=1/C13H10N2O2/c1-2-10(7-14-5-1)8-15-11-3-4-12-13(6-11)17-9-16-12/h1-8H,9H2/b15-8+

5-(1-aza-2-(3-pyridyl)vinyl)benzo[d]1,3-dioxolene

CAS: 77822-84-5

Please enquire for more information about 5-(1-aza-2-(3-pyridyl)vinyl)benzo[d]1,3-dioxolene including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 226.23 g/mol

Ref: 3D-CDA82284