CAS 77837-46-8
:4-Amino-N-[2-(dimethylamino)ethyl]benzenesulfonamide
Description:
4-Amino-N-[2-(dimethylamino)ethyl]benzenesulfonamide, with the CAS number 77837-46-8, is a chemical compound that belongs to the class of sulfonamides. It features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2) attached to an amine. This compound has an amino group (-NH2) and a dimethylamino group (-N(CH3)2) that contribute to its basicity and potential for hydrogen bonding. The presence of the benzene ring provides aromatic stability and influences its solubility and reactivity. Typically, sulfonamides exhibit antibacterial properties, and this compound may have applications in medicinal chemistry or as a building block for pharmaceuticals. Its molecular structure suggests it may interact with biological systems, potentially affecting enzyme activity or cellular processes. As with many sulfonamides, it is essential to consider its safety profile, including potential allergic reactions or toxicity, when evaluating its use in research or therapeutic contexts.
Formula:C10H17N3O2S
InChI:InChI=1S/C10H17N3O2S/c1-13(2)8-7-12-16(14,15)10-5-3-9(11)4-6-10/h3-6,12H,7-8,11H2,1-2H3
InChI key:InChIKey=HERALKCUSVEQOM-UHFFFAOYSA-N
SMILES:S(NCCN(C)C)(=O)(=O)C1=CC=C(N)C=C1
Synonyms:- Benzenesulfonamide, 4-amino-N-[2-(dimethylamino)ethyl]-
- NSC 688990
- 4-Amino-N-[2-(dimethylamino)ethyl]benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-amino-N-[2-(dimethylamino)ethyl]benzene-1-sulfonamide
CAS:Formula:C10H17N3O2SMolecular weight:243.3259
