CAS 7784-82-9
:N-cbz-pro-leu-gly ethyl ester
Description:
N-Cbz-pro-leu-gly ethyl ester is a chemical compound that belongs to the class of amino acid derivatives, specifically a peptide or peptide-like structure. It features a carbobenzyloxy (Cbz) protecting group, which is commonly used to protect the amino group of amino acids during peptide synthesis. The compound consists of a proline (pro), leucine (leu), and glycine (gly) sequence, indicating that it is a tripeptide. The ethyl ester functionality suggests that it is an esterified form of the carboxylic acid group, which can enhance its lipophilicity and potentially improve its bioavailability. This compound is typically used in peptide synthesis and research applications, particularly in the development of pharmaceuticals and biologically active molecules. Its properties, such as solubility and stability, can be influenced by the presence of the Cbz group and the ethyl ester moiety. As with many peptide derivatives, it may exhibit specific biological activities, making it of interest in medicinal chemistry and biochemistry.
Formula:C23H33N3O6
InChI:InChI=1/C23H33N3O6/c1-4-31-20(27)14-24-21(28)18(13-16(2)3)25-22(29)19-11-8-12-26(19)23(30)32-15-17-9-6-5-7-10-17/h5-7,9-10,16,18-19H,4,8,11-15H2,1-3H3,(H,24,28)(H,25,29)
SMILES:CCOC(=O)CN=C(C(CC(C)C)N=C(C1CCCN1C(=O)OCc1ccccc1)O)O
Synonyms:- Z-Pro-Leu-Gly-OEt
- Ethyl 1-[(Benzyloxy)Carbonyl]Prolylleucylglycinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S)-Benzyl 2-(((S)-1-((2-ethoxy-2-oxoethyl)amino)-4-methyl-1-oxopentan-2-yl)carbamoyl)pyrrolidine-1-carboxylate
CAS:Formula:C23H33N3O6Color and Shape:SolidMolecular weight:447.5246Z-Pro-Leu-Gly-OEt
CAS:<p>Z-Pro-Leu-Gly-OEt is a cyclic tripeptide that can be synthesized using ammonium sulfate as a catalyst. The reaction time required is between 4 and 12 hours, with the optimum at 8 hours. Resonances have been observed in the 1H NMR spectrum of Z-Pro-Leu-Gly-OEt. The most prominent resonance appears at δ 9.5 ppm. The cyclization of Z-Pro-Leu-Gly-OEt is catalysed by ammonium sulfate, which also produces a reaction yield of 100%. The effect of pH on the rate constant for the reaction has been studied and it was found that there was no significant difference in reactivity when the pH was varied between 7 and 11. Sulfoxide formation has also been monitored during synthesis, but concentrations are low enough to not affect the yield or reactivity of the product. The conformational structure of Z-Pro-Le</p>Formula:C23H33N3O6Purity:Min. 95%Molecular weight:447.52 g/molRef: 3D-FP111512
Discontinued product

