
CAS 77844-93-0
:Euglobal Ia1
Description:
Euglobal Ia1, with the CAS number 77844-93-0, is a chemical compound that belongs to a class of substances known for their biological activity, particularly in the context of plant growth regulation. This compound is typically characterized by its complex molecular structure, which may include various functional groups that contribute to its reactivity and interaction with biological systems. Euglobal Ia1 is often studied for its potential applications in agriculture, particularly as a biostimulant or growth enhancer, promoting plant health and resilience. Its properties may include solubility in specific solvents, stability under certain conditions, and the ability to influence physiological processes in plants. Additionally, research into Euglobal Ia1 may focus on its mechanisms of action, efficacy in different environmental conditions, and safety profile for both plants and non-target organisms. As with any chemical substance, understanding its characteristics is crucial for its effective and safe application in relevant fields.
Formula:C23H30O5
InChI:InChI=1S/C23H30O5/c1-12(2)8-15-18-9-14(13(3)4)6-7-23(18,5)28-22-17(11-25)20(26)16(10-24)21(27)19(15)22/h6-7,10-15,18,26-27H,8-9H2,1-5H3
InChI key:InChIKey=GCAXPYWXIWWHHT-UHFFFAOYSA-N
SMILES:C(C(C)C)C1C=2C(OC3(C)C1CC(C(C)C)C=C3)=C(C=O)C(O)=C(C=O)C2O
Synonyms:- 1H-Xanthene-5,7-dicarboxaldehyde, 2,4a,9,9a-tetrahydro-6,8-dihydroxy-4a-methyl-2-(1-methylethyl)-9-(2-methylpropyl)-, (8aR,9R,10aR)-
- 1H-Xanthene-5,7-dicarboxaldehyde, 2,4a,9,9a-tetrahydro-6,8-dihydroxy-4a-methyl-2-(1-methylethyl)-9-(2-methylpropyl)-
- Euglobal Ia1
- (8aR,9R,10aR)-2,4a,9,9a-Tetrahydro-6,8-dihydroxy-4a-methyl-2-(1-methylethyl)-9-(2-methylpropyl)-1H-xanthene-5,7-dicarboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Xanthene-5,7-dicarboxaldehyde, 2,4a,9,9a-tetrahydro-6,8-dihydroxy-4a-methyl-2-(1-methylethyl)-9-(2-methylpropyl)-, (8aR,9R,10aR)-
CAS:Formula:C23H30O5Purity:92.0%Color and Shape:SolidMolecular weight:386.4813Euglobal Ia1
CAS:Euglobal Ia1 is a natural product for research related to life sciences. The catalog number is TN5860 and the CAS number is 77844-93-0.Formula:C23H30O5Purity:98%Color and Shape:SolidMolecular weight:386.488Euglobal Ia1
CAS:Euglobal IA1 is a topical anesthetic cream designed to provide localized numbness. It is developed using synthesized active compounds that interact with nerve endings. The mode of action involves the reversible blockage of sodium ion channels in neuronal membranes, which inhibits nerve impulse transmission and results in temporary loss of sensation in the applied area.Formula:C23H30O5Purity:Min. 95%Color and Shape:PowderMolecular weight:386.48 g/mol


