CAS 77855-75-5

3,6,9,12,15-Pentaoxaheptadecanedioic acid

Description:

3,6,9,12,15-Pentaoxaheptadecanedioic acid, with the CAS number 77855-75-5, is a polyfunctional organic compound characterized by its long carbon chain and multiple ether linkages. This compound features five ether (–O–) groups interspersed within a 17-carbon backbone, which contributes to its unique properties, such as increased solubility in polar solvents and potential applications in polymer chemistry. The presence of two carboxylic acid groups (–COOH) at each end of the molecule enhances its reactivity, allowing it to participate in various chemical reactions, including esterification and amidation. Its structural characteristics suggest potential uses in the synthesis of biodegradable polymers, surfactants, and other materials that require flexibility and hydrophilicity. Additionally, the compound's molecular structure may influence its physical properties, such as melting and boiling points, making it suitable for specific applications in materials science and biochemistry. Overall, 3,6,9,12,15-Pentaoxaheptadecanedioic acid exemplifies the versatility of polyfunctional compounds in advanced chemical applications.

Formula: C₁₂H₂₂O₉

InChI: InChI=1S/C12H22O9/c13-11(14)9-20-7-5-18-3-1-17-2-4-19-6-8-21-10-12(15)16/h1-10H2,(H,13,14)(H,15,16)

InChI key: InChIKey=WIVPWKOWHCVJKT-UHFFFAOYSA-N

SMILES: O(CC(O)=O)CCOCCOCCOCCOCC(O)=O

Synonyms:

• 3,6,9,12,15-Pentaoxaheptadecane-1,17-dioic acid
• 3,6,9,12,15-Pentaoxaheptadecanedioic acid

3,6,9,12,15-Pentaoxaheptadecanedioic acid

CAS: 77855-75-5

Formula: C₁₂H₂₂O₉

Purity: 97%

Color and Shape: Liquid

Molecular weight: 310.2977

Ref: IN-DA008O8B

HOOCCH2O-PEG4-CH2COOH

CAS: 77855-75-5

HOOCCH2O-PEG4-CH2COOH

Purity: 97%

Molecular weight: 310.3g/mol

Ref: 54-OR1007759

HOOCCH2O-PEG4-CH2COOH

CAS: 77855-75-5

HOOCCH2O-PEG4-CH2COOH (compound 5) is a symmetric PEG linker used in Homo-PROTAC synthesis.

Formula: C₁₂H₂₂O₉

Color and Shape: Solid

Molecular weight: 310.3

Ref: TM-T15499

3,6,9,12,15-PENTAOXAHEPTADECANEDIOIC ACID

CAS: 77855-75-5

Purity: 97%

Color and Shape: Viscous Liquid

Molecular weight: 310.2990112

Ref: 10-F825396

HOOCCH2O-PEG4-CH2COOH

CAS: 77855-75-5

Bis-PEG5-acetic acid is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, bis-PEG5-acetic acid is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₁₂H₂₂O₉

Purity: Min. 95%

Molecular weight: 310.3 g/mol

Ref: 3D-CDA85575