CAS 77858-21-0
:5-(2-Formyl-3-hydroxyphenoxy)pentanoic acid
Description:
5-(2-Formyl-3-hydroxyphenoxy)pentanoic acid, identified by its CAS number 77858-21-0, is an organic compound characterized by its functional groups and structural features. It contains a pentanoic acid backbone, which is a five-carbon straight-chain fatty acid, and is substituted with a phenolic moiety that includes both a formyl group (-CHO) and a hydroxyl group (-OH) on the aromatic ring. This compound exhibits properties typical of both carboxylic acids and phenolic compounds, including potential acidity due to the carboxylic acid group and reactivity associated with the aldehyde and hydroxyl functionalities. The presence of these groups suggests that it may participate in various chemical reactions, such as esterification or oxidation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical or biochemical research. Its solubility and stability can vary depending on the pH and solvent conditions, which are important considerations for its practical applications. Overall, this compound's unique structure contributes to its potential utility in various chemical and biological contexts.
Formula:C12H14O5
InChI:InChI=1S/C12H14O5/c13-8-9-10(14)4-3-5-11(9)17-7-2-1-6-12(15)16/h3-5,8,14H,1-2,6-7H2,(H,15,16)
InChI key:InChIKey=NSUDGNLOXMLAEB-UHFFFAOYSA-N
SMILES:O(CCCCC(O)=O)C1=C(C=O)C(O)=CC=C1
Synonyms:- 12C79
- Pentanoic acid, 5-(2-formyl-3-hydroxyphenoxy)-
- 5-(2-Formyl-3-hydroxyphenoxy)valeric acid
- UNII-9EQV0XQ79B
- Pentanoic acid, 5-(2-formyl-3-hydroxyphenoxy)-
- 5-(2-Formyl-3-hydroxyphenoxy)pentanoic acid
- 5-(2-formyl-3-hydroxyphenoxy)pentanoic acid
- BW 12C79
- Velaresol [INN:BAN]
- BW 12C
- BW 12C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Velaresol
CAS:Velaresol (BW 12C79) is used for the study of tumors, sickle cell anemia and digestive disorders.Formula:C12H14O5Purity:99.46%Color and Shape:SolidMolecular weight:238.24Velaresol
CAS:Velaresol is a small molecule drug that binds to the CB2 receptor. It has been shown to have therapeutic potential in treating bowel diseases, such as inflammatory bowel disease and irritable bowel syndrome, as well as autoimmune diseases such as multiple sclerosis and type 1 diabetes. Velaresol has also been shown to be effective against cancer cells in vitro and in vivo, with a mechanism of action that is not yet understood. The drug also inhibits the production of proinflammatory cytokines and ameliorates inflammation by binding to toll-like receptors on immune cells. Velaresol has been synthesized using a biocompatible polymer, which may make it suitable for use in diagnostic applications.
Formula:C12H14O5Purity:Min. 95%Molecular weight:238.24 g/mol


