CymitQuimica logo

CAS 778593-18-3

:

1-(3-cyanopropyl)-3-methyl-1H-imidazol-3-ium bis[(trifluoromethyl)sulfonyl]azanide

Description:
1-(3-Cyanopropyl)-3-methyl-1H-imidazol-3-ium bis[(trifluoromethyl)sulfonyl]azanide, identified by its CAS number 778593-18-3, is an ionic liquid characterized by its unique imidazolium cation structure and the presence of bis(trifluoromethyl)sulfonyl)azanide anion. This compound typically exhibits low volatility and high thermal stability, making it suitable for various applications in organic synthesis and electrochemistry. The imidazolium cation contributes to its ionic nature, which often results in good solubility for a wide range of organic and inorganic compounds. Additionally, the presence of the trifluoromethyl groups enhances its chemical stability and hydrophobicity. This substance may also display interesting electrochemical properties, which can be advantageous in energy storage applications. Its unique combination of properties makes it a subject of interest in the development of advanced materials and solvents in green chemistry. As with all chemical substances, handling should be conducted with appropriate safety measures due to potential toxicity and reactivity.
Formula:C10H12F6N4O4S2
InChI:InChI=1/C8H12N3.C2F6NO4S2/c1-10-6-7-11(8-10)5-3-2-4-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-8H,2-3,5H2,1H3;/q+1;-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.