CAS 778611-65-7
:5-Bromo-4-(bromomethyl)-2-chloropyridine
Description:
5-Bromo-4-(bromomethyl)-2-chloropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with bromine and chlorine atoms. The presence of the bromomethyl group enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents. Its molecular structure contributes to its potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine and chlorine substituents can influence the compound's electronic properties, affecting its reactivity and interaction with other molecules. As with many halogenated compounds, it is essential to handle 5-Bromo-4-(bromomethyl)-2-chloropyridine with care due to potential toxicity and environmental concerns associated with halogenated organic compounds. Proper safety protocols should be followed during its use in laboratory settings.
Formula:C6H4Br2ClN
InChI:InChI=1S/C6H4Br2ClN/c7-2-4-1-6(9)10-3-5(4)8/h1,3H,2H2
InChI key:InChIKey=QNLGDTQQRGIQPC-UHFFFAOYSA-N
SMILES:C(Br)C=1C(Br)=CN=C(Cl)C1
Synonyms:- 5-Bromo-4-(bromomethyl)-2-chloropyridine
- Pyridine, 5-bromo-4-(bromomethyl)-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
