
CAS 77862-94-3
:Piperazine, 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[3-(4-fluorophenyl)propyl]-, dimethanesulfonate
Description:
Piperazine, 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[3-(4-fluorophenyl)propyl]-, dimethanesulfonate, identified by CAS number 77862-94-3, is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This compound features multiple functional groups, including methoxy and sulfonate moieties, which contribute to its solubility and reactivity. The presence of fluorinated phenyl groups enhances its lipophilicity and may influence its biological activity. Piperazine derivatives are often studied for their potential pharmacological properties, including anxiolytic and antidepressant effects. The dimethanesulfonate salt form indicates that it is likely used in a soluble form for various applications, possibly in medicinal chemistry or as a research chemical. Its specific interactions and effects would depend on the context of its use, including dosage and the biological system it interacts with. As with all chemical substances, proper handling and safety protocols should be observed due to potential toxicity or reactivity.
Formula:C28H31F3N2O·2CH4O3S
InChI:InChI=1S/C28H31F3N2O.CH4O3S/c29-25-9-3-22(4-10-25)2-1-15-32-16-18-33(19-17-32)20-21-34-28(23-5-11-26(30)12-6-23)24-7-13-27(31)14-8-24;1-5(2,3)4/h3-14,28H,1-2,15-21H2;1H3,(H,2,3,4)
InChI key:InChIKey=DOUSUVGBXMHOJS-UHFFFAOYSA-N
SMILES:C(OCCN1CCN(CCCC2=CC=C(F)C=C2)CC1)(C3=CC=C(F)C=C3)C4=CC=C(F)C=C4.S(C)(=O)(=O)O
Synonyms:- GBR 13098
- Piperazine, 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[3-(4-fluorophenyl)propyl]-, dimethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
GBR-13098 dimethanesulfonate
CAS:<p>GBR-13098 dimethanesulfonate is an inhibitor of dopamine uptake.</p>Formula:C30H39F3N2O7S2Color and Shape:SolidMolecular weight:660.76
