
CAS 778647-22-6
:N-(2,2,6,6-Tetramethyl-4-piperidinyl)guanidine
Description:
N-(2,2,6,6-Tetramethyl-4-piperidinyl)guanidine, with the CAS number 778647-22-6, is a chemical compound characterized by its unique structure that includes a guanidine moiety and a piperidine ring substituted with four methyl groups. This compound is known for its potential applications as a stabilizer in various chemical formulations, particularly in polymers and coatings, due to its ability to scavenge free radicals. The presence of the bulky tetramethylpiperidine group enhances its steric hindrance, which contributes to its stability and effectiveness as an antioxidant. Additionally, the guanidine part of the molecule can participate in hydrogen bonding, which may influence its solubility and interaction with other substances. Overall, N-(2,2,6,6-Tetramethyl-4-piperidinyl)guanidine is valued in industrial applications for its protective properties against oxidative degradation, making it a significant compound in materials science and chemistry.
Formula:C10H22N4
InChI:InChI=1S/C10H22N4/c1-9(2)5-7(13-8(11)12)6-10(3,4)14-9/h7,14H,5-6H2,1-4H3,(H4,11,12,13)
InChI key:InChIKey=AYLPVOFHYZCDCJ-UHFFFAOYSA-N
SMILES:N(C(=N)N)C1CC(C)(C)NC(C)(C)C1
Synonyms:- N-(2,2,6,6-Tetramethyl-4-piperidinyl)guanidine
- Guanidine, (2,2,6,6-tetramethyl-4-piperidinyl)-
- Guanidine, N-(2,2,6,6-tetramethyl-4-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.