CAS 77868-85-0

3-Bromo-1-phenyl-2-piperidinone

Description:

3-Bromo-1-phenyl-2-piperidinone is a chemical compound characterized by its piperidinone structure, which includes a bromine atom and a phenyl group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals. The presence of the bromine atom introduces unique reactivity, making it a useful intermediate in organic synthesis. The piperidinone moiety contributes to its biological activity, as piperidine derivatives are often found in numerous bioactive compounds. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its molecular structure allows for various functional group transformations, which can be exploited in synthetic pathways. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 3-Bromo-1-phenyl-2-piperidinone serves as an important building block in chemical research and development.

Formula: C₁₁H₁₂BrNO

InChI: InChI=1S/C11H12BrNO/c12-10-7-4-8-13(11(10)14)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2

InChI key: InChIKey=MFMWCNYXZVIHLW-UHFFFAOYSA-N

SMILES: O=C1N(CCCC1Br)C2=CC=CC=C2

Synonyms:

• 3-Bromo-1-phenyl-2-piperidinone
• 2-Piperidinone, 3-bromo-1-phenyl-

3-Bromo-1-phenylpiperidin-2-one

CAS: 77868-85-0

Versatile small molecule scaffold

Formula: C₁₁H₁₂BrNO

Purity: Min. 95%

Molecular weight: 254.12 g/mol

Ref: 3D-CDA86885