CAS 77869-23-9

(2E)-3-(5-methylfuran-2-yl)-1-(4-nitrophenyl)prop-2-en-1-one

Description:

The chemical substance known as (2E)-3-(5-methylfuran-2-yl)-1-(4-nitrophenyl)prop-2-en-1-one, with the CAS number 77869-23-9, is an organic compound characterized by its conjugated system, which includes a β-unsaturated carbonyl group. This structure contributes to its potential reactivity, particularly in electrophilic addition reactions. The presence of the 5-methylfuran moiety introduces a heterocyclic component that can influence the compound's electronic properties and solubility. Additionally, the 4-nitrophenyl group enhances the compound's electron-withdrawing characteristics, which can affect its stability and reactivity. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvent used. Overall, this compound's unique structural features suggest potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₄H₁₁NO₄

InChI: InChI=1/C14H11NO4/c1-10-2-7-13(19-10)8-9-14(16)11-3-5-12(6-4-11)15(17)18/h2-9H,1H3/b9-8+

Synonyms:

• (2E)-3-(5-Methyl-2-furyl)-1-(4-nitrophenyl)prop-2-en-1-one
• 2-propen-1-one, 3-(5-methyl-2-furanyl)-1-(4-nitrophenyl)-, (2E)-

(2E)-3-(5-methylfuran-2-yl)-1-(4-nitrophenyl)prop-2-en-1-one

CAS: 77869-23-9

Formula: C₁₄H₁₁NO₄

Purity: 95.0%

Molecular weight: 257.245

Ref: 10-F523647