CAS 77869-40-0
:Benzoic acid, 2-hydroxy-3-methoxy-4-methyl-
Description:
Benzoic acid, 2-hydroxy-3-methoxy-4-methyl-, commonly known as 4-methyl-2-hydroxy-3-methoxybenzoic acid, is an aromatic carboxylic acid characterized by its functional groups, which include a hydroxyl group (-OH), a methoxy group (-OCH3), and a carboxylic acid group (-COOH) attached to a benzene ring. This compound typically exhibits properties such as being a white crystalline solid at room temperature, with moderate solubility in water and higher solubility in organic solvents. It is known for its potential applications in the pharmaceutical and cosmetic industries due to its antioxidant and antimicrobial properties. The presence of the hydroxyl and methoxy groups contributes to its reactivity and ability to form hydrogen bonds, influencing its physical and chemical behavior. Additionally, this compound may be involved in various biochemical processes and can serve as a precursor in the synthesis of other organic compounds. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c1-5-3-4-6(9(11)12)7(10)8(5)13-2/h3-4,10H,1-2H3,(H,11,12)
InChI key:InChIKey=NVSYSDSIOHDHLQ-UHFFFAOYSA-N
SMILES:O(C)C1=C(O)C(C(O)=O)=CC=C1C
Synonyms:- 2-Hydroxy-3-methoxy-4-methylbenzoic acid
- Benzoic acid, 2-hydroxy-3-methoxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
