CAS 7787-82-8
:Trichloro(1-chloroethyl)silane
Description:
Trichloro(1-chloroethyl)silane, with the CAS number 7787-82-8, is an organosilicon compound characterized by its silane structure, where a silicon atom is bonded to three chlorine atoms and one 1-chloroethyl group. This compound is typically a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity and potential hazards. It is known for its ability to hydrolyze in the presence of moisture, releasing hydrochloric acid and forming silanol compounds, which can lead to the formation of siloxane networks. Trichloro(1-chloroethyl)silane is primarily used in the synthesis of silicone polymers and as a coupling agent in various chemical processes. Due to its chlorinated nature, it poses risks such as toxicity and environmental concerns, necessitating careful handling and storage. It is important to use appropriate personal protective equipment when working with this substance to mitigate exposure risks. Overall, its unique chemical properties make it valuable in industrial applications, particularly in materials science and surface modification.
Formula:C2H4Cl4Si
InChI:InChI=1S/C2H4Cl4Si/c1-2(3)7(4,5)6/h2H,1H3
InChI key:InChIKey=CAPIMQICDAJXSB-UHFFFAOYSA-N
SMILES:[Si](C(C)Cl)(Cl)(Cl)Cl
Synonyms:- (alpha-Chloroethyl)trichlorosilane
- (α-Chloroethyl)trichlorosilane
- Nsc 139827
- Silane, trichloro(1-chloroethyl)-
- Trichloro(1-chloroethyl)silane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.