CAS 77873-76-8

3-Morpholinecarboxylic acid

Description:

3-Morpholinecarboxylic acid, also known as morpholine-3-carboxylic acid, is an organic compound characterized by its morpholine ring structure with a carboxylic acid functional group at the 3-position. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which makes it useful in various applications. It has a moderate melting point and is stable under standard conditions. The presence of both the morpholine ring and the carboxylic acid group imparts unique chemical properties, allowing it to participate in various chemical reactions, including esterification and amidation. 3-Morpholinecarboxylic acid is often utilized in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.

Formula: C₅H₉NO₃

InChI: InChI=1/C5H9NO3/c7-5(8)4-3-9-2-1-6-4/h4,6H,1-3H2,(H,7,8)

SMILES: C1COCC(C(=O)O)N1

Synonyms:

• Morpholine-3-carboxylic acid

3-Morpholinecarboxylic acid

CAS: 77873-76-8

Formula: C₅H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 131.1299

Ref: IN-DA0033RP

Morpholine-3-carboxylic acid

CAS: 77873-76-8

Morpholine-3-carboxylic acid

Purity: 98%

Molecular weight: 131.13g/mol

Ref: 54-OR74728

3-Morpholinecarboxylic acid

CAS: 77873-76-8

Formula: C₅H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 131.131

Ref: 10-F208782