CAS 77880-59-2

4,7-dimethyl-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione

Description:

4,7-Dimethyl-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione, with the CAS number 77880-59-2, is a chemical compound characterized by its complex bicyclic structure, which includes a benzofuran moiety and an epoxy group. This compound features multiple methyl groups that contribute to its hydrophobic characteristics and influence its reactivity. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its tetrahydro structure suggests that it is a saturated derivative, which may enhance its stability compared to unsaturated analogs. The epoxy group can serve as a reactive site, making it useful in synthetic applications or as an intermediate in organic synthesis. Additionally, compounds of this type may exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, the unique structural features of this compound make it of interest in both synthetic chemistry and potential applications in medicinal chemistry.

Formula: C₁₀H₁₀O₄

InChI: InChI=1/C10H10O4/c1-9-3-4-10(2,14-9)6-5(9)7(11)13-8(6)12/h3-6H,1-2H3

SMILES: CC12C=CC(C)(C3C1C(=O)OC3=O)O2