CAS 77881-08-4
:Angeloylgomisin P
Description:
Angeloylgomisin P, with the CAS number 77881-08-4, is a natural compound classified as a lignan, which is a type of polyphenolic compound. It is primarily derived from various plant sources, particularly those in the genus Schisandra. This compound is characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups that contribute to its biological activity. Angeloylgomisin P has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. Its mechanism of action may involve the modulation of various signaling pathways and the inhibition of specific enzymes. Additionally, the compound's solubility and stability can vary depending on environmental conditions, which may influence its bioavailability and therapeutic efficacy. Research continues to explore its full range of biological effects and potential applications in health and medicine.
Formula:C28H34O9
InChI:InChI=1S/C28H34O9/c1-9-14(2)27(29)37-26-17-12-18(31-5)22(32-6)25(34-8)21(17)20-16(10-15(3)28(26,4)30)11-19-23(24(20)33-7)36-13-35-19/h9,11-12,15,26,30H,10,13H2,1-8H3
InChI key:InChIKey=BKGUPIVDQHHVMV-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(=CC4=C(C3OC)OCO4)CC(C)C(C)(O)C(OC(C(=CC)C)=O)C2=CC(OC)=C1OC
Synonyms:- Angelogomisin P
- Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole, 2-butenoic acid deriv.
- 2-Butenoic acid, 2-methyl-, (5R,6R,7S,13aS)-5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 5,6,7,8-tetrahydro-6-hydroxy-1,2,3,13-tetramethoxy-6,7-dimethylbenzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-5-yl ester, stereoisomer
- Angeloylgomisin P
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Angeloylgomisin P
CAS:<p>Angeloylgomisin P is a useful organic compound for research related to life sciences. The catalog number is T124224 and the CAS number is 77881-08-4.</p>Formula:C28H34O9Color and Shape:SolidMolecular weight:514.571
