
CAS 77891-29-3
:4-Ethoxy-3-methoxybenzeneethanol
Description:
4-Ethoxy-3-methoxybenzeneethanol, also known by its CAS number 77891-29-3, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with ethoxy and methoxy groups, as well as a hydroxyl group (alcohol). This compound typically exhibits properties associated with both ethers and alcohols, such as moderate solubility in organic solvents and potential hydrogen bonding due to the presence of the hydroxyl group. The ethoxy and methoxy substituents can influence its reactivity and polarity, making it useful in various chemical applications, including as a potential intermediate in organic synthesis or in the formulation of certain products. Its molecular structure suggests that it may have applications in the fields of pharmaceuticals, agrochemicals, or as a solvent. However, specific physical properties such as boiling point, melting point, and density would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C11H16O3
InChI:InChI=1S/C11H16O3/c1-3-14-10-5-4-9(6-7-12)8-11(10)13-2/h4-5,8,12H,3,6-7H2,1-2H3
InChI key:InChIKey=XYPMGJKFSRTMFY-UHFFFAOYSA-N
SMILES:O(C)C1=C(OCC)C=CC(CCO)=C1
Synonyms:- Phenethyl alcohol, 4-ethoxy-3-methoxy-
- 4-Ethoxy-3-methoxybenzeneethanol
- 2-(4-Ethoxy-3-methoxyphenyl)ethanol
- 2-(4-Ethoxy-3-methoxyphenyl)ethan-1-ol
- Benzeneethanol, 4-ethoxy-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.