CAS 77894-69-0

1-methyl-1H-indazol-4-amine

Description:

1-Methyl-1H-indazol-4-amine, with the CAS number 77894-69-0, is a chemical compound that belongs to the class of indazoles, which are five-membered heterocyclic compounds containing two nitrogen atoms. This substance features a methyl group attached to the nitrogen atom at the 1-position and an amino group at the 4-position of the indazole ring. It is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar organic solvents. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, which may include anti-cancer properties. Its molecular structure allows for interactions with biological targets, making it a candidate for drug development. Additionally, 1-methyl-1H-indazol-4-amine may undergo typical organic reactions, such as substitution and coupling, which are common for amines and heterocycles. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₉N₃

InChI: InChI=1/C8H9N3/c1-11-8-4-2-3-7(9)6(8)5-10-11/h2-5H,9H2,1H3

SMILES: Cn1c2cccc(c2cn1)N

Synonyms:

• 1H-Indazol-4-amine, 1-methyl-

1-Methyl-1H-indazol-4-amine

CAS: 77894-69-0

Formula: C₈H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.1772

Ref: IN-DA005R8Y

4-Amino-1-methyl-1H-indazole

CAS: 77894-69-0

4-Amino-1-methyl-1H-indazole

Formula: C₈H₉N₃

Purity: ≥95%

Color and Shape: light yellow to brown solid

Molecular weight: 147.18g/mol

Ref: 54-OR2151

1-Methyl-1H-indazol-4-amine

CAS: 77894-69-0

Formula: C₈H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.181

Ref: 10-F079551