CAS 77897-92-8

N-(4-Bromo-3-chloro-phenyl)-formamide

Description:

N-(4-Bromo-3-chloro-phenyl)-formamide is an organic compound characterized by its functional groups, including an amide and halogen substituents. The presence of the bromo and chloro groups on the phenyl ring contributes to its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound typically exhibits moderate solubility in polar organic solvents due to the amide functional group, which can engage in hydrogen bonding. Its molecular structure suggests that it may have biological activity, making it of interest in pharmaceutical research. The compound's stability is influenced by the electronic effects of the halogen substituents, which can affect its reactivity and interaction with other molecules. Additionally, safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks. Overall, N-(4-Bromo-3-chloro-phenyl)-formamide is a notable compound in organic synthesis and medicinal chemistry, with potential applications in drug development and material science.

Formula: C₇H₅BrClNO

Synonyms:

• Formamide, N-(4-bromo-3-chlorophenyl)-
• N-(4-Bromo-3-chloro-phenyl)-formamide