CAS 779-27-1
:7-Hydroxycoumarin-3-carboxylic acid
Description:
7-Hydroxycoumarin-3-carboxylic acid, with the CAS number 779-27-1, is a chemical compound belonging to the coumarin family, characterized by its fused benzene and α-pyrone rings. This compound features a hydroxyl group at the 7-position and a carboxylic acid group at the 3-position, which contribute to its solubility and reactivity. It typically appears as a crystalline solid and is known for its fluorescent properties, making it useful in various applications, including as a fluorescent marker in biochemical assays. The compound exhibits moderate to high stability under standard conditions but may be sensitive to strong acids or bases. Its derivatives are often studied for potential pharmacological activities, including antimicrobial and anti-inflammatory effects. Additionally, 7-hydroxycoumarin-3-carboxylic acid can participate in various chemical reactions, such as esterification and acylation, which are valuable in synthetic organic chemistry. Overall, its unique structural features and reactivity make it a compound of interest in both research and industrial applications.
Formula:C10H6O5
InChI:InChI=1S/C10H6O5/c11-6-2-1-5-3-7(9(12)13)10(14)15-8(5)4-6/h1-4,11H,(H,12,13)
InChI key:InChIKey=LKLWLDOUZJEHDY-UHFFFAOYSA-N
SMILES:O=C1OC=2C(C=C1C(O)=O)=CC=C(O)C2
Synonyms:- 2H-1-Benzopyran-3-carboxylic acid, 7-hydroxy-2-oxo-
- 3-Carboxy-7-hydroxycoumarin
- 3-Carboxyumbelliferone
- 7-Hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid
- 7-Hydroxy-2-oxobenzopyran-3-carboxylic acid
- 7-Hydroxycoumarin carboxylic acid
- 7-Hydroxycoumarin-3-Carboxylic Acid
- 7-Hydroxycoumarinyl-3-carboxylic acid
- NSC 115545
- Umbelliferone-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
7-Hydroxycoumarin-3-carboxylic Acid
CAS:Formula:C10H6O5Purity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:206.152H-1-Benzopyran-3-carboxylic acid, 7-hydroxy-2-oxo-
CAS:Formula:C10H6O5Purity:98%Color and Shape:SolidMolecular weight:206.15167-Hydroxycoumarin-3-carboxylic acid
CAS:7-Hydroxycoumarin-3-carboxylic acidPurity:≥98%Molecular weight:206.15g/mol7-Hydroxycoumarin-3-carboxylic acid
CAS:7-Hydroxycoumarin-3-carboxylic acidFormula:C10H6O5Purity:98%Color and Shape:Beige SolidMolecular weight:206.15g/mol7-Hydroxycoumarin-3-carboxylic acid
CAS:7-Hydroxycoumarin-3-carboxylic acid (7-HC-3-CA) is a safe anti-browning agent that inhibits tyrosinase activity, useful for studying food preservation.Formula:C10H6O5Purity:99.94%Color and Shape:SolidMolecular weight:206.157-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid
CAS:Formula:C10H6O5Purity:95%Color and Shape:Solid, Very pale yellow to pale yellow powderMolecular weight:206.153Umbelliferone-3-carboxylic acid
CAS:Umbelliferone-3-carboxylic acid is a coumarin derivative, which is a type of natural or synthetic organic compound often utilized in biochemical research. It is sourced from modifications of natural coumarins, which are typically isolated from plants belonging to the Apiaceae family, such as parsley, celery, and carrots. This compound functions by interacting with cellular enzymes, providing a fluorescent probe that aids in the investigation of enzymatic activities and pathways.
Formula:C10H6O5Purity:Min. 95%Color and Shape:PowderMolecular weight:206.15 g/mol






