CAS 779-90-8
:1,1′,1′′-(1,3,5-Benzenetriyl)tris[ethanone]
Description:
1,1′,1′′-(1,3,5-Benzenetriyl)tris[ethanone], also known as tris(acetyl)benzene, is an organic compound characterized by its structure, which features a central benzene ring substituted with three acetyl groups. This compound is typically a white to light yellow crystalline solid, exhibiting a relatively high melting point. It is soluble in organic solvents such as ethanol, acetone, and chloroform, but has limited solubility in water due to its hydrophobic nature. The presence of multiple acetyl groups contributes to its reactivity, making it a useful intermediate in organic synthesis and a potential ligand in coordination chemistry. Additionally, it can participate in various chemical reactions, including acylation and condensation reactions. The compound's unique structure and functional groups allow it to exhibit interesting properties, such as fluorescence and potential applications in materials science and pharmaceuticals. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C12H12O3
InChI:InChI=1S/C12H12O3/c1-7(13)10-4-11(8(2)14)6-12(5-10)9(3)15/h4-6H,1-3H3
InChI key:InChIKey=HSOAIPRTHLEQFI-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(C(C)=O)=CC(C(C)=O)=C1
Synonyms:- 1,1',1''-Benzene-1,3,5-Triyltriethanone
- 1,1′,1′′-(1,3,5-Benzenetriyl)tris[ethanone]
- 1-(3,5-Diacetylphenyl)ethan-1-one
- 1-(3,5-Diacetylphenyl)ethanone
- Benzene, 1,3,5-triacetyl-
- Ethanone, 1,1′,1′′-(1,3,5-benzenetriyl)tris-
- NSC 61943
- 1,3,5-Triacetylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3,5-Triacetylbenzene
CAS:Formula:C12H12O3Purity:>98.0%(GC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:204.231,1',1''-(Benzene-1,3,5-triyl)triethanone
CAS:Formula:C12H12O3Purity:97%Color and Shape:SolidMolecular weight:204.22191,1',1''-(Benzene-1,3,5-triyl)tris(ethan-1-one)
CAS:1,1',1''-(Benzene-1,3,5-triyl)tris(ethan-1-one)Purity:97%Molecular weight:204.23g/mol1,3,5-Triacetylbenzene
CAS:1,3,5-Triacetylbenzene is a triacetate of benzene. It is an antimicrobial agent that has been shown to be active against bacteria and fungi. The mechanism of action involves the nucleophilic attack of an enolate on chloride with ethyl formate as a reaction intermediate. This reaction leads to the formation of methyl ketones, which are crosslinkers for proteins, and model studies have shown that this compound can react with DNA. 1,3,5-Triacetylbenzene has been shown to inhibit the growth of some bacteria and fungi in culture.Formula:C12H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:204.22 g/mol1,1′,1”-(Benzene-1,3,5-triyl)triethanone
CAS:Formula:C12H12O3Purity:95%Color and Shape:SolidMolecular weight:204.225




