CAS 7790-37-6
:zinc iodate
Description:
Zinc iodate, with the chemical formula Zn(IO3)2 and CAS number 7790-37-6, is an inorganic compound that consists of zinc cations and iodate anions. It typically appears as a white crystalline solid and is soluble in water, which makes it useful in various applications. Zinc iodate is known for its oxidizing properties and can be used in analytical chemistry as a reagent. The compound is stable under normal conditions but should be handled with care due to its potential reactivity, especially in the presence of reducing agents. It is often utilized in the synthesis of other chemical compounds and may also have applications in agriculture as a micronutrient source for plants. Additionally, zinc iodate can be involved in various chemical reactions, contributing to the study of coordination chemistry and the behavior of iodate ions in different environments. Proper safety measures should be observed when handling this compound, as with any chemical substance.
Formula:I2O6Zn
InChI:InChI=1/HIO3.Zn/c2-1(3)4;/h(H,2,3,4);/q;+2/p-1
InChI key:InChIKey=LVNYYHDKIOGNBI-UHFFFAOYSA-N
SMILES:I(=O)(=O)O.[Zn]
Synonyms:- Iodic acid (HIO3), zinc salt
- Iodic acid (HIO<sub>3</sub>), zinc salt
- Zinc iodate (Zn(IO<sub>3</sub>)<sub>2</sub>)
- Zine iodate
- Zinc iodate (Zn(IO3)2)
- Zinc iodate
- Einecs 232-202-1
- Zinc iodate ISO 9001:2015 REACH
- zinc,diiodate
- Bisiodic acid zinc salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.