CAS 7791-71-1
:5'-O-tritylthymidine
Description:
5'-O-Tritylthymidine is a modified nucleoside that features a thymidine base with a trityl protecting group at the 5' hydroxyl position. This compound is characterized by its structural components, which include a pyrimidine base (thymine) linked to a deoxyribose sugar. The trityl group, a bulky aromatic hydrocarbon moiety, serves to protect the hydroxyl group from unwanted reactions during synthetic processes, making it valuable in nucleic acid chemistry, particularly in the synthesis of oligonucleotides. The presence of the trityl group enhances the compound's stability and solubility in organic solvents. 5'-O-Tritylthymidine is typically used in biochemical applications, including DNA synthesis and modification, where selective deprotection is required to facilitate further reactions. Its CAS number, 7791-71-1, is a unique identifier that allows for easy reference in chemical databases. Overall, this compound plays a crucial role in the field of molecular biology and synthetic chemistry, enabling researchers to manipulate nucleic acids with precision.
Formula:C29H28N2O5
InChI:InChI=1/C29H28N2O5/c1-20-18-31(28(34)30-27(20)33)26-17-24(32)25(36-26)19-35-29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18,24-26,32H,17,19H2,1H3,(H,30,33,34)
SMILES:Cc1cn(C2CC(C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)O)c(=O)nc1O
Synonyms:- Thymidine, 5'-O-(triphenylmethyl)-
- 1-(2-deoxy-5-O-tritylpentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-((2R,4S,5R)-4-Hydroxy-5-((Trityloxy)Methyl)Tetrahydrofuran-2-Yl)-5-Methylpyrimidine-2,4(1H,3H)-Dione
CAS:1-((2R,4S,5R)-4-Hydroxy-5-((Trityloxy)Methyl)Tetrahydrofuran-2-Yl)-5-Methylpyrimidine-2,4(1H,3H)-DionePurity:98%Molecular weight:484.55g/mol5'-O-Tritylthymidine
CAS:5'-O-Tritylthymidine is a nucleoside that is found in human mitochondrial DNA. It is synthesized from uridine by the enzyme thymidylate synthase and can be converted to thymine by the enzyme thymidine phosphorylase. 5'-O-Tritylthymidine has been shown to inhibit cancer cell growth, but its mechanism of action is not clear. It may inhibit xylene production. 5'-O-Tritylthymidine also causes an increase in p53 activity, which may lead to apoptosis of cancer cells.Formula:C29H28N2O5Purity:Min. 95%Molecular weight:484.54 g/mol5′-O-Tritylthymidine
CAS:Formula:C29H28N2O5Purity:97%,contains <10%DCM)Color and Shape:LiquidMolecular weight:484.5525'-O-Tritylthymidine
CAS:5'-O-Tritylthymidine blocks FAK/Mdm-2, activates p53 & caspase-8, promoting apoptosis in breast/colon cancer.Formula:C29H28N2O5Color and Shape:SolidMolecular weight:484.54






