CAS 779309-80-7
:2-phenyl-1,3-diazaspiro[4.4]non-1-en-4-one
Description:
2-Phenyl-1,3-diazaspiro[4.4]non-1-en-4-one is a heterocyclic compound characterized by its unique spiro structure, which consists of a bicyclic framework featuring two nitrogen atoms in a diazine configuration. This compound typically exhibits a fused ring system, contributing to its rigidity and potential biological activity. The presence of the phenyl group enhances its lipophilicity, which may influence its solubility and interaction with biological targets. The enone functional group suggests the potential for reactivity, particularly in nucleophilic addition reactions. Additionally, the compound may display interesting optical properties due to its conjugated system. Its structural features may confer specific pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, 2-phenyl-1,3-diazaspiro[4.4]non-1-en-4-one represents a class of compounds that could be explored for various applications, including drug development and material science, owing to its distinctive chemical characteristics.
Formula:C13H14N2O
InChI:InChI=1/C13H14N2O/c16-12-13(8-4-5-9-13)15-11(14-12)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15,16)
Synonyms:- 2-Phenyl-1,3-diazaspiro[4.4]non-1-en-4-one
- 2-Phenyl-1,3-diazaspiro[4.4]non-1-en-4-on
- 1,3-diazaspiro[4.4]non-1-en-4-one, 2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.