CymitQuimica logo

CAS 779310-89-3

:

5-(Aminomethyl)-3-methyl-2-thiophenecarbonitrile

Description:
5-(Aminomethyl)-3-methyl-2-thiophenecarbonitrile, with the CAS number 779310-89-3, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an aminomethyl group, which contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. The presence of a carbonitrile functional group indicates that it has a cyano group (-C≡N), which can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. The methyl group attached to the thiophene ring enhances its lipophilicity, potentially influencing its biological activity. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it a candidate for further research in drug development or material science. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions and the presence of other functional groups.
Formula:C7H8N2S
InChI:InChI=1S/C7H8N2S/c1-5-2-6(3-8)10-7(5)4-9/h2H,3,8H2,1H3
InChI key:InChIKey=VYSCDLZIYMYEOY-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C)C=C(CN)S1
Synonyms:
  • 5-(Aminomethyl)-3-methyl-2-thiophenecarbonitrile
  • 2-Thiophenecarbonitrile, 5-(aminomethyl)-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.