
CAS 779339-15-0
:4-Piperidinamine, 1-(cyclohexylmethyl)-, hydrochloride (1:2)
Description:
4-Piperidinamine, 1-(cyclohexylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclohexylmethyl group enhances its lipophilicity, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry, especially for its potential effects on the central nervous system or as a therapeutic agent. Its molecular structure suggests it could interact with various biological targets, although specific activity would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, 4-Piperidinamine, 1-(cyclohexylmethyl)-, hydrochloride (1:2) represents a compound with significant potential in research and development within the field of medicinal chemistry.
Formula:C12H24N2·2ClH
InChI:InChI=1S/C12H24N2.2ClH/c13-12-6-8-14(9-7-12)10-11-4-2-1-3-5-11;;/h11-12H,1-10,13H2;2*1H
InChI key:InChIKey=JKNVKLQUUHESTH-UHFFFAOYSA-N
SMILES:C(N1CCC(N)CC1)C2CCCCC2.Cl
Synonyms:- 4-Piperidinamine, 1-(cyclohexylmethyl)-, hydrochloride (1:2)
- 4-Piperidinamine, 1-(cyclohexylmethyl)-, dihydrochloride
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery