CAS 779345-37-8

5-fluoro-2-nitropyridine

Description:

5-Fluoro-2-nitropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with both a fluorine atom and a nitro group. The presence of these functional groups imparts unique chemical properties to the molecule. The fluorine atom, being electronegative, can influence the compound's reactivity and polarity, while the nitro group is known for its strong electron-withdrawing effects, which can enhance the acidity of adjacent hydrogen atoms. This compound typically appears as a yellow to brown solid and is soluble in organic solvents. It is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the compound's structure allows for potential applications in materials science and as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₅H₃FN₂O₂

InChI: InChI=1/C5H3FN2O2/c6-4-1-2-5(7-3-4)8(9)10/h1-3H

SMILES: c1cc(ncc1F)N(=O)=O

Synonyms:

• Pyridine, 5-Fluoro-2-Nitro-

5-Fluoro-2-nitropyridine

CAS: 779345-37-8

Formula: C₅H₃FN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 142.0879

Ref: IN-DA003MRB

5-Fluoro-2-nitropyridine

CAS: 779345-37-8

5-Fluoro-2-nitropyridine

Formula: C₅H₃FN₂O₂

Purity: ≥95%

Color and Shape: light yellow to yellow solid

Molecular weight: 142.09g/mol

Ref: 54-PC445034

5-Fluoro-2-nitropyridine

CAS: 779345-37-8

Formula: C₅H₃FN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.089

Ref: 10-F079771