CAS 779352-05-5
:1-Methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione
Description:
1-Methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. The presence of a methyl group at the 1-position and a trifluoromethyl group at the 7-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioactivity. As with many heterocycles, the compound may exhibit interesting electronic properties, making it a subject of interest in materials science and organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, particularly those with fluorinated groups.
Formula:C9H6F3N3O2
InChI:InChI=1S/C9H6F3N3O2/c1-15-6-4(7(16)14-8(15)17)2-3-5(13-6)9(10,11)12/h2-3H,1H3,(H,14,16,17)
InChI key:InChIKey=XMZKZQWDROKDEO-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=O)NC1=O)=CC=C(C(F)(F)F)N2
Synonyms:- Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, 1-methyl-7-(trifluoromethyl)-
- 1-Methyl-7-(trifluoromethyl)-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-2,4-dione
- 1-Methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.